MC-Val-Ala-PBD structure
|
Common Name | MC-Val-Ala-PBD | ||
|---|---|---|---|---|
| CAS Number | 1342820-51-2 | Molecular Weight | 1089.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C60H64N8O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-Val-Ala-PBDMC-Val-Ala-PBD is a drug-linker conjugate for ADC by using the antitumor antibiotic, pyrrolobenzodiazepine (PBD, a cytotoxic DNA crosslinking), linked via the cleavable linker MC-Val-Ala[1]. |
| Name | (S)-2-((S)-2-(6-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-hexanamido)-3-methylbutanamido)propanoic acid |
|---|
| Description | MC-Val-Ala-PBD is a drug-linker conjugate for ADC by using the antitumor antibiotic, pyrrolobenzodiazepine (PBD, a cytotoxic DNA crosslinking), linked via the cleavable linker MC-Val-Ala[1]. |
|---|---|
| Related Catalog | |
| Target |
Pyrrolobenzodiazepines |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C60H64N8O12 |
|---|---|
| Molecular Weight | 1089.20000 |
| Exact Mass | 1088.46000 |
| PSA | 236.17000 |
| LogP | 7.11240 |
| InChIKey | TWQIMWSQDICMSE-DGCIIGOYSA-N |
| SMILES | COc1ccc(C2=CN3C(=O)c4cc(OC)c(OCCCOc5cc6c(cc5OC)C(=O)N5C=C(c7ccc(NC(=O)C(C)NC(=O)C(NC(=O)CCCCCN8C(=O)C=CC8=O)C(C)C)cc7)CC5C=N6)cc4N=CC3C2)cc1 |