5-(2 4-DICHLOROPHENYL)-2-FUROIC ACID 9& structure
|
Common Name | 5-(2 4-DICHLOROPHENYL)-2-FUROIC ACID 9& | ||
|---|---|---|---|---|
| CAS Number | 134448-46-7 | Molecular Weight | 257.07000 | |
| Density | 1.477g/cm3 | Boiling Point | 400.9ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2O3 | Melting Point | 220-224ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 196.3ºC | |
| Name | 5-(2,4-dichlorophenyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 400.9ºC at 760 mmHg |
| Melting Point | 220-224ºC (dec.)(lit.) |
| Molecular Formula | C11H6Cl2O3 |
| Molecular Weight | 257.07000 |
| Flash Point | 196.3ºC |
| Exact Mass | 255.96900 |
| PSA | 50.44000 |
| LogP | 3.95160 |
| Vapour Pressure | 3.79E-07mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | LYDQZIXGFBEQKT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~70%
5-(2 4-DICHLORO... CAS#:134448-46-7 |
| Literature: Holla, B. Shivarama; Rao, B. Sooryanarayana; Gonsalves, Richard; Sarojini; Shridhara Farmaco, 2002 , vol. 57, # 8 p. 693 - 696 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5-(2,4-dichlorophenyl)-2-furancarboxylic acid |
| 5-(2,4-Dichlorophenyl)-2-furoic acid |
| 5-(2,4-dichlorophenyl)furoic acid |
| MFCD01860297 |