Thromboxane B2-d4 structure
|
Common Name | Thromboxane B2-d4 | ||
|---|---|---|---|---|
| CAS Number | 1346112-79-5 | Molecular Weight | 374.50500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30D4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thromboxane B2-d4Thromboxane B2-D4 is the deuterium labeled Thromboxane B2. Thromboxane B2 is a prostaglandin derivative that is released during anaphylaxis. Thromboxane B2 induces arterial contraction and platelet aggregation[1][2]. |
| Name | (5Z,9β,13E,15S)-9,11,15-Trihydroxy(3,3,4,4-2H4)thromboxa-5,13-dien-1-oic acid |
|---|
| Description | Thromboxane B2-D4 is the deuterium labeled Thromboxane B2. Thromboxane B2 is a prostaglandin derivative that is released during anaphylaxis. Thromboxane B2 induces arterial contraction and platelet aggregation[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C20H30D4O6 |
|---|---|
| Molecular Weight | 374.50500 |
| Exact Mass | 374.26100 |
| PSA | 107.22000 |
| LogP | 2.76940 |
| InChIKey | XNRNNGPBEPRNAR-LCGOHBJFSA-N |
| SMILES | CCCCCC(O)C=CC1OC(O)CC(O)C1CC=CCCCC(=O)O |