Mono(3-carboxypropyl) Phthalate-d4 structure
|
Common Name | Mono(3-carboxypropyl) Phthalate-d4 | ||
|---|---|---|---|---|
| CAS Number | 1346600-69-8 | Molecular Weight | 256.24 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 507.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H8D4O6 | Melting Point | 110-112° C | |
| MSDS | N/A | Flash Point | 198.8±19.4 °C | |
Use of Mono(3-carboxypropyl) Phthalate-d4Mono(3-carboxypropyl) phthalate-d4 (MCPP-d4) is a deuterium labeled Mono(3-carboxypropyl) phthalate (HY-133673). Mono(3-carboxypropyl) phthalate (MCPP) is a metabolite of Di-n-octyl phthalate. Di-n-octyl phthalate (DnOP) is a plasticizer used in polyvinyl chloride plastics, cellulose esters, and polystyrene resins[1][2]. |
| Name | Mono(3-carboxypropyl) Phthalate-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Mono(3-carboxypropyl) phthalate-d4 (MCPP-d4) is a deuterium labeled Mono(3-carboxypropyl) phthalate (HY-133673). Mono(3-carboxypropyl) phthalate (MCPP) is a metabolite of Di-n-octyl phthalate. Di-n-octyl phthalate (DnOP) is a plasticizer used in polyvinyl chloride plastics, cellulose esters, and polystyrene resins[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.0±35.0 °C at 760 mmHg |
| Melting Point | 110-112° C |
| Molecular Formula | C12H8D4O6 |
| Molecular Weight | 256.24 |
| Flash Point | 198.8±19.4 °C |
| Exact Mass | 256.088501 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | IYTPMLIWBZMBSL-GYABSUSNSA-N |
| SMILES | O=C(O)CCCOC(=O)c1ccccc1C(=O)O |
| 2-[(3-Carboxypropoxy)carbonyl](2H4)benzoic acid |
| MCPP-d4 |
| 1,2-Benzenedicarboxylic Acid Mono(3-carboxypropyl) Ester-d4 |
| 1,2-Benzene-d4-dicarboxylic acid, mono(3-carboxypropyl) ester |