strontium iodate structure
|
Common Name | strontium iodate | ||
|---|---|---|---|---|
| CAS Number | 13470-01-4 | Molecular Weight | 437.42500 | |
| Density | N/A | Boiling Point | 70 °C | |
| Molecular Formula | I2O6Sr | Melting Point | 5°C | |
| MSDS | N/A | Flash Point | 70-72°C/15mm | |
| Name | strontium,diiodate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 70 °C |
|---|---|
| Melting Point | 5°C |
| Molecular Formula | I2O6Sr |
| Molecular Weight | 437.42500 |
| Flash Point | 70-72°C/15mm |
| Exact Mass | 437.68400 |
| PSA | 114.40000 |
| LogP | 1.05860 |
| Index of Refraction | 1.47 |
| InChIKey | JKGZNVNIOGGUKH-UHFFFAOYSA-L |
| SMILES | [O-][I+2]([O-])[O-].[O-][I+2]([O-])[O-].[Sr+2] |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| Strontium iodate |
| AC1L4YRE |
| EINECS 236-729-8 |
| CTK4B9363 |
| strontium diiodate |
| Iodic acid (HIO3),strontium salt |
| strontium(2+) diiodate |