Ethanone,1-(4'-nitro[1,1'-biphenyl]-4-yl)- structure
|
Common Name | Ethanone,1-(4'-nitro[1,1'-biphenyl]-4-yl)- | ||
|---|---|---|---|---|
| CAS Number | 135-69-3 | Molecular Weight | 241.24200 | |
| Density | 1.217g/cm3 | Boiling Point | 400ºC at 760mmHg | |
| Molecular Formula | C14H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 1-[4-(4-nitrophenyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 400ºC at 760mmHg |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24200 |
| Flash Point | 191.2ºC |
| Exact Mass | 241.07400 |
| PSA | 62.89000 |
| LogP | 3.98760 |
| Vapour Pressure | 1.32E-06mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | CVSGKJVJFSEPSO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Ethanone,1-(4'-nitro(1,1'-biphenyl)-4-yl) |
| 1-(4'-Nitro-biphenyl-4-yl)-aethanon |
| 4-(4'-nitrophenyl)acetophenone |
| 4-acetyl-4'-nitrodiphenyl |
| 4'-(p-Nitrophenyl)acetophenone |
| 4-Acetyl-4'-nitrobiphenyl |
| 1-(4'-nitro[1,1'-biphenyl]-4-yl)ethan-1-one |
| Acetophenone,4'-(p-nitrophenyl) |
| 4-nitrobiphenyl |
| EINECS 205-212-9 |
| 1-(4'-nitrobiphenyl-4-yl)ethanone |