methyl 4'-amino[1, 1'-biphenyl]-4- carboxylate structure
|
Common Name | methyl 4'-amino[1, 1'-biphenyl]-4- carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5730-76-7 | Molecular Weight | 227.25900 | |
| Density | 1.166g/cm3 | Boiling Point | 382.5ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | 179-182ºC | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | Methyl 4'-amino-[1,1'-biphenyl]-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 382.5ºC at 760 mmHg |
| Melting Point | 179-182ºC |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 220.2ºC |
| Exact Mass | 227.09500 |
| PSA | 52.32000 |
| LogP | 3.30360 |
| Index of Refraction | 1.602 |
| InChIKey | KKPVZEJEFMQVSQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccc(N)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Inhibition of PTP1B (unknown origin) using pNPP as substrate at 20 ug/ml
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL3240342
|
|
Name: Inhibition of PTP1B (unknown origin) using pNPP as substrate
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL3240343
|
| Methyl 4'-amino[1,1'-biphenyl]-4-carboxylate |