Orismilast structure
|
Common Name | Orismilast | ||
|---|---|---|---|---|
| CAS Number | 1353546-86-7 | Molecular Weight | 510.29 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 788.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H15Cl2F2NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 430.9±32.9 °C | |
Use of OrismilastOrismilast (LEO-32731) is a PDE4 inhibitor used for the research of inflammatory diseases[1]. |
| Name | Leo-32731 |
|---|---|
| Synonym | More Synonyms |
| Description | Orismilast (LEO-32731) is a PDE4 inhibitor used for the research of inflammatory diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 788.8±60.0 °C at 760 mmHg |
| Molecular Formula | C19H15Cl2F2NO7S |
| Molecular Weight | 510.29 |
| Flash Point | 430.9±32.9 °C |
| Exact Mass | 508.991425 |
| LogP | 0.82 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | ZININGNRPUGNSL-UHFFFAOYSA-N |
| SMILES | O=C(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c2c1OC1(CCS(=O)(=O)CC1)O2 |
| Leo-32731 |
| Ethanone, 2-(3,5-dichloro-1-oxido-4-pyridinyl)-1-[7-(difluoromethoxy)-2',3',5',6'-tetrahydro-1',1'-dioxidospiro[1,3-benzodioxole-2,4'-[4H]thiopyran]-4-yl]- |
| 2-(3,5-Dichloro-1-oxido-4-pyridinyl)-1-[7-(difluoromethoxy)-1',1'-dioxido-2',3',5',6'-tetrahydrospiro[1,3-benzodioxole-2,4'-thiopyran]-4-yl]ethanone |