Benzamide,2,4-dichloro-3,5-dinitro- structure
|
Common Name | Benzamide,2,4-dichloro-3,5-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 13550-88-4 | Molecular Weight | 280.02200 | |
| Density | 1.798g/cm3 | Boiling Point | 310.7ºC at 760 mmHg | |
| Molecular Formula | C7H3Cl2N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.7ºC | |
| Name | 2,4-dichloro-3,5-dinitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.798g/cm3 |
|---|---|
| Boiling Point | 310.7ºC at 760 mmHg |
| Molecular Formula | C7H3Cl2N3O5 |
| Molecular Weight | 280.02200 |
| Flash Point | 141.7ºC |
| Exact Mass | 278.94500 |
| PSA | 134.73000 |
| LogP | 3.65540 |
| Vapour Pressure | 0.000591mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | UBMOQSTZFCSCEV-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,2,4-d... CAS#:13550-88-4 |
| Literature: The Upjohn Company Patent: US4091011 A1, 1978 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.4-Dichlor-3.5-dinitro-benzamid |