2,4-Dichloro-3,5-dinitro benzotrifluoride structure
|
Common Name | 2,4-Dichloro-3,5-dinitro benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 29091-09-6 | Molecular Weight | 304.995 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 314.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C7HCl2F3N2O4 | Melting Point | 76-78°C | |
| MSDS | N/A | Flash Point | 144.1±26.5 °C | |
| Name | 2,4-Dichloro-3,5-dinitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.6±37.0 °C at 760 mmHg |
| Melting Point | 76-78°C |
| Molecular Formula | C7HCl2F3N2O4 |
| Molecular Weight | 304.995 |
| Flash Point | 144.1±26.5 °C |
| Exact Mass | 303.926544 |
| PSA | 91.64000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | DPQYRXNRGNLPFC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Cl |
| Hazard Codes | Xi: Irritant;T: Toxic; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
|
~60%
2,4-Dichloro-3,... CAS#:29091-09-6 |
| Literature: Hori, Hitoshi; Noguchi, Naoto; Yokoyama, Hideakira; Ise, Hirohiko; Jin, Cheng-Zhe; Kasai, Soko; Goto, Takatsugu; Taira, Zenei Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 2 p. 247 - 253 |
|
~%
2,4-Dichloro-3,... CAS#:29091-09-6 |
| Literature: Montedison S.p.A. Patent: US4110405 A1, 1978 ; |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-Dichloro-3,5-nitrobenzotrifluoride |
| Benzene, 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)- |
| 2,4-dichloro-3,5-dinitrotrifluoromethylbenzene |
| EINECS 249-420-8 |
| MFCD00042480 |
| 2,4-Dichloro-3,5-Dinitrobenzotrifluoride |
| 1,3-dichloro-2,4-dinitro-6-trifluoromethylbenzene |
| 2,4-Dichloro-3,5-din |
| 1,3-Dichloro-2,6-dinitro-4-trifluoromethylbenzene |
| 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene |
| 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)-benzen |
| BENZENE,2,4-DICHLORO-1,3-DINITRO-5-(TRIFLUOROMETHYL) |
| 2,4-Dichloro-3,5-Dinitrobenzotrifluoride/3,5-Dinitro-2,4-Dichlo |
| 2,4-Dichloro-3,5-dinitro benzotrifluoride |