(+)-Isocorydine hydrochloride structure
|
Common Name | (+)-Isocorydine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 13552-72-2 | Molecular Weight | 377.86200 | |
| Density | 1.222 g/cm3 | Boiling Point | 506.1ºC at 760 mmHg | |
| Molecular Formula | C20H24ClNO4 | Melting Point | 216-220 °C(lit.) | |
| MSDS | USA | Flash Point | 259.9ºC | |
| Name | isocorydine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222 g/cm3 |
|---|---|
| Boiling Point | 506.1ºC at 760 mmHg |
| Melting Point | 216-220 °C(lit.) |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.86200 |
| Flash Point | 259.9ºC |
| Exact Mass | 377.13900 |
| PSA | 51.16000 |
| LogP | 3.91000 |
| InChIKey | ZWSKLEMBDRWSNZ-ZOWNYOTGSA-N |
| SMILES | COc1ccc2c(c1O)-c1c(OC)c(OC)cc3c1C(C2)N(C)CC3.Cl |
| Storage condition | -20°C |
| Hazard Codes | T: Toxic; |
|---|---|
| Safety Phrases | S16-S23-S45-S22-S7 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | CE1057950 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~%
(+)-Isocorydine... CAS#:13552-72-2 |
| Literature: Ferreira, Marcia L.R.; de Pascoli, Inara C.; Nascimento, Isabele R.; Zukerman-Schpector, Julio; Lopes, Lucia M.X. Phytochemistry, 2010 , vol. 71, # 4 p. 469 - 478 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition of electric eel AChE at 2 mg/ml by Ellman's method
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL2166270
|
|
Name: Inhibition of horse BChE at 2 mg/ml by Ellman's method
Source: ChEMBL
Target: Cholinesterase
External Id: CHEMBL2166271
|
| Prestwick_281 |
| LUTEANINE HYDROCHLORIDE |
| MFCD00134198 |
| d-Isocorydine chloride |
| LUTEANINE |
| ARTABOTRINE |