Galanin (1-19), human
Modify Date: 2025-08-21 12:08:06
Galanin (1-19), human structure
|
Common Name | Galanin (1-19), human | ||
|---|---|---|---|---|
| CAS Number | 136005-51-1 | Molecular Weight | 1964.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C89H130N26O25 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Galanin (1-19), humanGalanin (1-19), human is the 1-19 fragment of the human galanin. Galanin (GAL) is a widely distributed neuropeptide with diverse biological effectsincluding modulation of hormone release, antinociception and modification of feeding behavior[1]. |
| Name | Galanin (1-19) (human) |
|---|---|
| Synonym | More Synonyms |
| Description | Galanin (1-19), human is the 1-19 fragment of the human galanin. Galanin (GAL) is a widely distributed neuropeptide with diverse biological effectsincluding modulation of hormone release, antinociception and modification of feeding behavior[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C89H130N26O25 |
|---|---|
| Molecular Weight | 1964.14 |
| Exact Mass | 1962.97000 |
| PSA | 798.35000 |
| LogP | 0.40250 |
| InChIKey | UKPCKEWJIIKMHQ-WNXXINOUSA-N |
| SMILES | CC(C)CC(NC(=O)C(CC(C)C)NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(N)=O)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CN)C(C)O)C(=O)NCC(=O)N1CCCC1C(=O)NC(Cc1c[nH]cn1)C(=O)NC(C)C(=O)NC(C(=O)NCC(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]cn1)C(=O)O)C(C)C |
| h-gly-trp-thr-leu-asn-ser-ala-gly-tyr-leu-leu-gly-pro-his-ala-val-gly-asn-his-oh |
| gly-trp-thr-leu-asn-ser-ala-gly-tyr-leu-leu-gly-pro-his-ala-val-gly-asn-his |