DPP-IV-IN-2 structure
|
Common Name | DPP-IV-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 136259-18-2 | Molecular Weight | 378.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DPP-IV-IN-2DPP-IV-IN-2 is an inhibitor of both dipeptidyl peptidase IV (DPIV) and DP8/9 with IC50s of 0.1 and 0.95 μM, respectively. |
| Name | H-Lys(4-nitro-Z)-pyrrolidide |
|---|---|
| Synonym | More Synonyms |
| Description | DPP-IV-IN-2 is an inhibitor of both dipeptidyl peptidase IV (DPIV) and DP8/9 with IC50s of 0.1 and 0.95 μM, respectively. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.1 μM (DPIV), 0.95 μM (DP8/9)[1] |
| References |
| Molecular Formula | C18H26N4O5 |
|---|---|
| Molecular Weight | 378.42300 |
| Exact Mass | 378.19000 |
| PSA | 130.48000 |
| LogP | 3.49330 |
| InChIKey | YDYSCRZHYWLSPQ-INIZCTEOSA-N |
| SMILES | NC(CCCCNC(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)N1CCCC1 |
| lys(4-nitro-Z)pyrrolidide |
| Lys-Z-nitro-pyrrolidine |
| Lys[Z(NO2)] pyrrolidide |
| DPP-IV-IN-2 |