2,2-Dibromo-1-(4-chlorophenyl)ethanone structure
|
Common Name | 2,2-Dibromo-1-(4-chlorophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 13651-12-2 | Molecular Weight | 312.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5Br2ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-Dibromo-1-(4-chlorophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5Br2ClO |
|---|---|
| Molecular Weight | 312.38600 |
| Exact Mass | 309.84000 |
| PSA | 17.07000 |
| LogP | 3.63860 |
| InChIKey | UBWBLFIQIJHEDN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)C(Br)Br |
| HS Code | 2914700090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Ethanone,2,2-dibromo-1-(4-chlorophenyl) |
| 2,2-Dibrom-1-(4-chlor-phenyl)-aethanon |
| InChI=1/C8H5Br2ClO/c9-8(10)7(12)5-1-3-6(11)4-2-5/h1-4,8 |
| 2,2-BIS-(4-FLUOROPHENYL)-TETRAHYDROFURAN |
| 2,2-dibromo-1-(4'-chlorophenyl)ethanone |
| 2,2-Dibrom-1-(4-chlor-phenyl)-aethanon-(1) |
| 2,2-dibromo-1-(4-chloro-phenyl)-ethanone-(1) |
| 2,2-dibromo-4'-chloroacetophenone |