2,6-DIMETHYL-D-TYROSINE structure
|
Common Name | 2,6-DIMETHYL-D-TYROSINE | ||
|---|---|---|---|---|
| CAS Number | 136771-16-9 | Molecular Weight | 209.24200 | |
| Density | 1.242g/cm3 | Boiling Point | 412.8ºC at 760 mmHg | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
Use of 2,6-DIMETHYL-D-TYROSINE2,6-Dimethyl-d-tyrosine is a tyrosine derivative[1]. |
| Name | (2R)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2,6-Dimethyl-d-tyrosine is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 412.8ºC at 760 mmHg |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24200 |
| Flash Point | 203.4ºC |
| Exact Mass | 209.10500 |
| PSA | 83.55000 |
| LogP | 1.66370 |
| Vapour Pressure | 1.49E-07mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | LSNDLIKCFHLFKO-SNVBAGLBSA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(N)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Dimethyl-D-tyrosine |