3-fluoro-4-phenylbenzoic acid structure
|
Common Name | 3-fluoro-4-phenylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 137045-30-8 | Molecular Weight | 216.20800 | |
| Density | 1.261g/cm3 | Boiling Point | 366.3ºC at 760 mmHg | |
| Molecular Formula | C13H9FO2 | Melting Point | 223-227ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 175.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-fluoro-4-phenylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 366.3ºC at 760 mmHg |
| Melting Point | 223-227ºC(lit.) |
| Molecular Formula | C13H9FO2 |
| Molecular Weight | 216.20800 |
| Flash Point | 175.3ºC |
| Exact Mass | 216.05900 |
| PSA | 37.30000 |
| LogP | 3.19090 |
| Vapour Pressure | 5.21E-06mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | PFKITESTTSWHMP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccccc2)c(F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
|
~%
3-fluoro-4-phen... CAS#:137045-30-8 |
| Literature: WO2008/152149 A1, ; Page/Page column 37-38; 79 ; WO 2008/152149 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| UNII-Z6XXN3O38O |
| 2-Fluorobiphenyl-4-carboxylic Acid |
| MFCD05664334 |
| 2-fluoro-4-biphenylacetic acid |
| Flurbiprofen EP Impurity E |