3-Fluoro-4-nitrobenzoic acid structure
|
Common Name | 3-Fluoro-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 403-21-4 | Molecular Weight | 185.109 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 372.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO4 | Melting Point | 174-175°C | |
| MSDS | USA | Flash Point | 179.3±23.7 °C | |
| Name | 3-Fluoro-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.8±27.0 °C at 760 mmHg |
| Melting Point | 174-175°C |
| Molecular Formula | C7H4FNO4 |
| Molecular Weight | 185.109 |
| Flash Point | 179.3±23.7 °C |
| Exact Mass | 185.012436 |
| PSA | 83.12000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | WVZBIQSKLXJFNX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37 |
| HS Code | 2942000000 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD01862092 |
| WNR BF DVQ |
| 3-Fluoro-4-nitrobenzoic acid |