GA3-AM structure
|
Common Name | GA3-AM | ||
|---|---|---|---|---|
| CAS Number | 1373154-68-7 | Molecular Weight | 418.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GA3-AMGA3-AM is a cell permeable analog of the plant hormone gibberellic acid that acts as a chemical dimerizer or chemical inducer of dimerization[1]. |
| Name | Gibberellic Acid Acetoxymethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | GA3-AM is a cell permeable analog of the plant hormone gibberellic acid that acts as a chemical dimerizer or chemical inducer of dimerization[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Gibberellic acid (GA3) is an efficient plant growth regulator, which could speed up barley germination in the brewing industry[1]. |
| References |
| Molecular Formula | C22H26O8 |
|---|---|
| Molecular Weight | 418.43700 |
| Exact Mass | 418.16300 |
| PSA | 119.36000 |
| LogP | 1.00630 |
| InChIKey | IVIYFJSPDLOPEX-AXKFECAUSA-N |
| SMILES | C=C1CC23CC1(O)CCC2C12C=CC(O)C(C)(C(=O)O1)C2C3C(=O)OCOC(C)=O |
| 4a,1-(Epoxymethano)-7,9a-methanobenz[a]azulene-10-acetic acid, 1,2,4b,5,6,7,8,9,10,10a-decahydro-2,7-dihydroxy-1-methyl-8-methylene-13-oxo-, (acetyloxy)methyl ester, (1S,2S,4aR,4bR,7S,9aS,10S,10aR)- |