BMS-984923
Modify Date: 2024-01-01 21:42:43
BMS-984923 structure
|
Common Name | BMS-984923 | ||
|---|---|---|---|---|
| CAS Number | 1375752-78-5 | Molecular Weight | 374.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BMS-984923BMS-984923, a potent mGluR5 silent allosteric modulator (SAM), with exquisite binding affinity (Ki = 0.6 nM), exhibits good oral bioavailability and BBB penetration. BMS-984923 potently inhibits the PrPC-mGluR5 interaction and prevents pathological Aβo signaling without affecting physiological glutamate signaling. |
| Name | BMS-984923 |
|---|
| Description | BMS-984923, a potent mGluR5 silent allosteric modulator (SAM), with exquisite binding affinity (Ki = 0.6 nM), exhibits good oral bioavailability and BBB penetration. BMS-984923 potently inhibits the PrPC-mGluR5 interaction and prevents pathological Aβo signaling without affecting physiological glutamate signaling. |
|---|
| Molecular Formula | C22H15ClN2O2 |
|---|---|
| Molecular Weight | 374.82 |
| InChIKey | IAYVUQJOKDFLAL-NHCUHLMSSA-N |
| SMILES | O=C1NC(c2cncc(C#Cc3ccccc3)c2)C(c2ccccc2Cl)O1 |