Benzoic acid, 2,3,6-trihydroxy-4-methyl
Modify Date: 2025-09-09 20:24:32
Benzoic acid, 2,3,6-trihydroxy-4-methyl structure
|
Common Name | Benzoic acid, 2,3,6-trihydroxy-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 1378838-01-7 | Molecular Weight | 184.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid, 2,3,6-trihydroxy-4-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8O5 |
|---|---|
| Molecular Weight | 184.15 |
| InChIKey | CXFDJNAJPFBQGN-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(=O)O)c(O)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: InChIKey of Benzoic acid, 2,3,6-trihydroxy-4-methyl is CXFDJNAJPFBQGN-UHFFFAOYSA-N. |
| Q: What is the CAS number of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: CAS number of Benzoic acid, 2,3,6-trihydroxy-4-methyl is 1378838-01-7. |
| Q: What is the molecular weight of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: Molecular weight of Benzoic acid, 2,3,6-trihydroxy-4-methyl is 184.15. |
| Q: What is the Chinese name of 1378838-01-7? |
| A: Chinese name of 1378838-01-7 is 1378838-01-7. |
| Q: What is the molecular formula of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: Molecular formula of Benzoic acid, 2,3,6-trihydroxy-4-methyl is C8H8O5. |
| Q: What is the SMILES notation of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: SMILES notation of Benzoic acid, 2,3,6-trihydroxy-4-methyl is Cc1cc(O)c(C(=O)O)c(O)c1O. |
| Q: What is the English name of Benzoic acid, 2,3,6-trihydroxy-4-methyl? |
| A: The English name of Benzoic acid, 2,3,6-trihydroxy-4-methyl is Benzoic acid, 2,3,6-trihydroxy-4-methyl. |