Bis-3,5-Dichlorophenyl disulfide structure
|
Common Name | Bis-3,5-Dichlorophenyl disulfide | ||
|---|---|---|---|---|
| CAS Number | 137897-99-5 | Molecular Weight | 356.118 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 429.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Cl4S2 | Melting Point | 66-69 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.1±25.9 °C | |
| Name | Bis(3,5-dichlorophenyl) disulfide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.7±45.0 °C at 760 mmHg |
| Melting Point | 66-69 °C(lit.) |
| Molecular Formula | C12H6Cl4S2 |
| Molecular Weight | 356.118 |
| Flash Point | 197.1±25.9 °C |
| Exact Mass | 353.866516 |
| PSA | 50.60000 |
| LogP | 6.76 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | JMQANWHMOHXBEA-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(SSc2cc(Cl)cc(Cl)c2)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
|
~80%
Bis-3,5-Dichlor... CAS#:137897-99-5 |
| Literature: Russian Chemical Bulletin, , vol. 53, # 2 p. 420 - 434 |
|
~%
Bis-3,5-Dichlor... CAS#:137897-99-5 |
| Literature: US2003/60665 A1, ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Design of potent poxvirus inhibitors of the heterodimeric processivity factor required for viral replication.
J. Med. Chem. 56(8) , 3235-46, (2013) Smallpox constitutes a major bioterrorism threat, which underscores the need to develop antiviral drugs for rapid response in the event of an attack. Viral processivity factors are attractive drug tar... |
| MFCD01862261 |
| 1,1'-Disulfanediylbis(3,5-dichlorobenzene) |
| 1,3-dichloro-5-[(3,5-dichlorophenyl)disulfanyl]benzene |
| Bis(3,5-dichlorophenyl) disulfide |
| Bis-3,5-Dichlorophenyl disulfide |
| 3,3',5,5'-TETRACHLORODIPHENYL DISULFIDE |
| Disulfide, bis(3,5-dichlorophenyl) |