3,5-Dichlorobenzenesulfonyl chloride structure
|
Common Name | 3,5-Dichlorobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 705-21-5 | Molecular Weight | 245.511 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 334.4±32.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl3O2S | Melting Point | 32-35 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 156.0±25.1 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3,5-Dichlorobenzenesulfonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.4±32.0 °C at 760 mmHg |
| Melting Point | 32-35 °C(lit.) |
| Molecular Formula | C6H3Cl3O2S |
| Molecular Weight | 245.511 |
| Flash Point | 156.0±25.1 °C |
| Exact Mass | 243.891937 |
| PSA | 42.52000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(Cl)cc(Cl)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~97%
3,5-Dichloroben... CAS#:705-21-5 |
| Literature: Pu, Yu-Ming; Christesen, Alan; Ku, Yi-Yin Tetrahedron Letters, 2010 , vol. 51, # 2 p. 418 - 421 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5-Dichlorobenzenesulphonyl chloride |
| WSGR CG EG |
| 3,5-Dichlorobenzenesulfonyl chloride |
| MFCD00051698 |