DpC structure
|
Common Name | DpC | ||
|---|---|---|---|---|
| CAS Number | 1382469-39-7 | Molecular Weight | 353.48 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 510.7±48.0 °C at 760 mmHg | |
| Molecular Formula | C19H23N5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 262.7±29.6 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | DPC |
|---|---|
| Synonym | More Synonyms |
| Description | DpC is an anti-tumor agent. DpC inhibits cancer cell proliferation (IC50: 0.007-0.096 渭M). DpC synergizes with multiple anti-cancer therapeutics[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.7±48.0 °C at 760 mmHg |
| Molecular Formula | C19H23N5S |
| Molecular Weight | 353.48 |
| Flash Point | 262.7±29.6 °C |
| Exact Mass | 353.167419 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | GNLZNQJBZNOUBM-UHFFFAOYSA-N |
| SMILES | CN(C(=S)NN=C(c1ccccn1)c1ccccn1)C1CCCCC1 |
| Storage condition | 20°C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | T |
| RIDADR | UN 2811 6.1 / PGIII |
|
The proto-oncogene c-Src and its downstream signaling pathways are inhibited by the metastasis suppressor, NDRG1.
Oncotarget 6 , 8851-74, (2015) N-myc downstream regulated gene-1 (NDRG1) is a potent metastasis suppressor that plays a key role in regulating signaling pathways involved in mediating cancer cell invasion and migration, including t... |
|
|
The Metastasis Suppressor, N-MYC Downstream-regulated Gene-1 (NDRG1), Down-regulates the ErbB Family of Receptors to Inhibit Downstream Oncogenic Signaling Pathways.
J. Biol. Chem. 291 , 1029-52, (2016) N-MYC downstream-regulated gene-1 (NDRG1) is a potent growth and metastasis suppressor that acts through its inhibitory effects on a wide variety of cellular signaling pathways, including the TGF-β pa... |
| DI-2-PYRIDYLKETONE 4-CYCLOHEXYL-4-METHYL-3-THIOSEMICARBAZONE |
| N-Cyclohexyl-2-(di-2-pyridinylmethylene)-N-methylhydrazinecarbothioamide |
| Hydrazinecarbothioamide, N-cyclohexyl-2-(di-2-pyridinylmethylene)-N-methyl- |
| DPC |
| Di-2-pyridylketone-4-cyclohexyl-4-methyl-3-thiosemicarbazone |
| MFCD22666593 |