NSC 3120-d3 structure
|
Common Name | NSC 3120-d3 | ||
|---|---|---|---|---|
| CAS Number | 1386387-74-1 | Molecular Weight | 214.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H2D3NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NSC 3120-d3NSC 3120-d3 is the deuterium labeled NSC 3120[1]. |
| Name | NSC 3120-d3 |
|---|
| Description | NSC 3120-d3 is the deuterium labeled NSC 3120[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C8H2D3NO6 |
|---|---|
| Molecular Weight | 214.15 |
| InChIKey | KFIRODWJCYBBHY-CBYSEHNBSA-N |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)O |