bis(4-methylphenoxy)-oxophosphanium structure
|
Common Name | bis(4-methylphenoxy)-oxophosphanium | ||
|---|---|---|---|---|
| CAS Number | 13869-19-7 | Molecular Weight | 261.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-methylphenoxy)-oxophosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14O3P |
|---|---|
| Molecular Weight | 261.23300 |
| Exact Mass | 261.06800 |
| PSA | 69.67000 |
| LogP | 4.41860 |
| InChIKey | NKTMXKKCADFXKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O[P+](=O)Oc2ccc(C)cc2)cc1 |
|
~95%
bis(4-methylphe... CAS#:13869-19-7 |
| Literature: Page, Patrick; Mazieres, Marie-Rose; Bellan, Jacques; Sanchez, Michel Phosphorus, Sulfur and Silicon and the Related Elements, 1992 , vol. 70, # 3/4 p. 205 - 210 |
|
~%
bis(4-methylphe... CAS#:13869-19-7 |
| Literature: Houalla; Wolf Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1958 , vol. 247, p. 482,484 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| phosphonic acid di-p-tolyl ester |
| di(p-tolyl) phosphonate |
| Phosphonic acid,bis(4-methylphenyl) ester |
| Phosphonsaeure-di-p-tolylester |