phenyl bis(4-methylphenoxy)phosphorylformate structure
|
Common Name | phenyl bis(4-methylphenoxy)phosphorylformate | ||
|---|---|---|---|---|
| CAS Number | 74270-17-0 | Molecular Weight | 382.34600 | |
| Density | 1.257g/cm3 | Boiling Point | 492.2ºC at 760 mmHg | |
| Molecular Formula | C21H19O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6ºC | |
| Name | phenyl bis(4-methylphenoxy)phosphorylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760 mmHg |
| Molecular Formula | C21H19O5P |
| Molecular Weight | 382.34600 |
| Flash Point | 264.6ºC |
| Exact Mass | 382.09700 |
| PSA | 71.64000 |
| LogP | 6.15330 |
| Index of Refraction | 1.585 |
| InChIKey | IORAAQDUDVGXSM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)C(=O)Oc2ccccc2)cc1 |
|
~%
phenyl bis(4-me... CAS#:74270-17-0 |
| Literature: Noren; Helgstrand; Johansson; Misiorny; Stening Journal of Medicinal Chemistry, 1983 , vol. 26, # 2 p. 264 - 270 |
| di-p-tolyl phenoxycarbonylphosphonate |