1-([1,1'-BIPHENYL]-4-YL)-3-(DIMETHYLAMINO)PROP-2-EN-1-ONE structure
|
Common Name | 1-([1,1'-BIPHENYL]-4-YL)-3-(DIMETHYLAMINO)PROP-2-EN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 138716-22-0 | Molecular Weight | 251.32300 | |
| Density | 1.062g/cm3 | Boiling Point | 392.4ºC at 760mmHg | |
| Molecular Formula | C17H17NO | Melting Point | 134-136ºC | |
| MSDS | N/A | Flash Point | 146.9ºC | |
| Name | 1-[1,1'-Biphenyl]-4-yl-3-(dimethylamino)-2-propen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 392.4ºC at 760mmHg |
| Melting Point | 134-136ºC |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.32300 |
| Flash Point | 146.9ºC |
| Exact Mass | 251.13100 |
| PSA | 20.31000 |
| LogP | 3.61160 |
| Vapour Pressure | 2.29E-06mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | VOZCAYLHVNCRJS-OUKQBFOZSA-N |
| SMILES | CN(C)C=CC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2922399090 |
|---|
|
~69%
1-([1,1'-BIPHEN... CAS#:138716-22-0 |
| Literature: Xu, Zhong-Lin; Li, Hong-Xi; Ren, Zhi-Gang; Du, Wei-Yuan; Xu, Wei-Chang; Lang, Jian-Ping Tetrahedron, 2011 , vol. 67, # 29 p. 5282 - 5288 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-([1,1'-Biphenyl]-4-yl)-3-(diMethylaMino)prop-2-en-1-one |
| 1-[1,1'-Biphenyl]-4-yl-3-(dimethylammino)-2-propen-1-one |
| 3-dimethylamino-1-(biphenyl-4-yl)-prop-2-en-1-one |
| 3-dimethylamino-1(4-biphenyl)prop-2-enone |
| 1-biphenyl-4-yl-3-(dimethylamino)propen-1-one |