4-Biphenylcarboxylic acid structure
|
Common Name | 4-Biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 92-92-2 | Molecular Weight | 198.217 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 372.6±21.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O2 | Melting Point | 220-225 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 170.0±16.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Biphenylcarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.6±21.0 °C at 760 mmHg |
| Melting Point | 220-225 °C(lit.) |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.217 |
| Flash Point | 170.0±16.7 °C |
| Exact Mass | 198.068085 |
| PSA | 37.30000 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | NNJMFJSKMRYHSR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1 |
| Storage condition | Room temperature. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | DV1925100 |
| HS Code | 29163900 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Air to lung partition coefficients for volatile organic compounds and blood to lung partition coefficients for volatile organic compounds and drugs.
Eur. J. Med. Chem. 43 , 478-85, (2008) Values of in vitro gas to lung partition coefficients, K(lung), of VOCs have been collected from the literature. For 44 VOCs, application of the Abraham solvation equation to log K(lung) yielded a cor... |
|
|
Synthesis of mercaptopropyl-(phenylene)s-benzoates passivated gold nanoparticles: Implications for plasmonic photovoltaic cells.
J. Colloid. Interface Sci. 456 , 182-9, (2015) The incorporation of gold nanoparticles in heterojunction solar cells is expected to increase the efficiency due to plasmon effects, but the literature studies are sometimes controversial. In this wor... |
|
|
Predicting human serum albumin affinity of interleukin-8 (CXCL8) inhibitors by 3D-QSPR approach.
J. Med. Chem. 48 , 2469-79, (2005) A novel class of 2-(R)-phenylpropionamides has been recently reported to inhibit in vitro and in vivo interleukin-8 (CXCL8)-induced biological activities. These CXCL8 inhibitors are derivatives of phe... |
| [1,1'-Biphenyl]-4-carboxylic acid |
| Biphenyl-4-carboxylic acid |
| p-Phenylbenzoic Acid |
| 4-Phenylbenzic acid |
| 4-Carboxybiphenyl |
| PHENYLBENZOICACID |
| EINECS 202-203-1 |
| RARECHEM AL BO 0062 |
| 4-phenyl benzoic acid |
| 4-Biphenylcarboxylic |
| 4-Phenylbenzoic Acid |
| 4-CARBOXYDIPHENYL |
| 4-United acid |
| 4-Biphenylcarboxylic acid |
| MFCD00002553 |