3-Benzyl-2-mercapto-3H-quinazolin-4-one structure
|
Common Name | 3-Benzyl-2-mercapto-3H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 13906-05-3 | Molecular Weight | 268.33400 | |
| Density | 1.36g/cm3 | Boiling Point | 441.6ºC at 760mmHg | |
| Molecular Formula | C15H12N2OS | Melting Point | >250ºC | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 3-benzyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760mmHg |
| Melting Point | >250ºC |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.33400 |
| Flash Point | 220.9ºC |
| Exact Mass | 268.06700 |
| PSA | 69.88000 |
| LogP | 3.10740 |
| Vapour Pressure | 5.37E-08mmHg at 25°C |
| Index of Refraction | 1.724 |
| InChIKey | PSPZHJCIFHRWNP-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1Cc1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzyl-2-thioxotetrahydroquinazolin-4-one |
| 3-benzyl-2,3-dihydro-2-thioxoquinazolin-4(1H)-one |
| 3-Benzyl-2-thioxo-2,3-dihydro-1H-quinazolin-4-one |
| N3-benzyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-benzyl-2-thioxo-1,2-dihydro-4(3H)-quinazolinone |
| 3-Benzyl-2-thioxo-2,3-dihydro-1H-chinazolin-4-on |
| 3-benzyl-2-thioxo-2,3-dihydroquinazolin-4(1H)-one |
| 3-Benzyl-2-mercapto-3H-quinazolin-4-one |