Bis(1-benzotriazolyl)methanethione structure
|
Common Name | Bis(1-benzotriazolyl)methanethione | ||
|---|---|---|---|---|
| CAS Number | 4314-19-6 | Molecular Weight | 280.30800 | |
| Density | 1.58g/cm3 | Boiling Point | 509.1ºC at 760 mmHg | |
| Molecular Formula | C13H8N6S | Melting Point | 170-174ºC(lit.) | |
| MSDS | N/A | Flash Point | 261.7ºC | |
| Name | Bis(1-benzotriazolyl)methanethione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 509.1ºC at 760 mmHg |
| Melting Point | 170-174ºC(lit.) |
| Molecular Formula | C13H8N6S |
| Molecular Weight | 280.30800 |
| Flash Point | 261.7ºC |
| Exact Mass | 280.05300 |
| PSA | 93.51000 |
| LogP | 1.85730 |
| Index of Refraction | 1.859 |
| InChIKey | ZRXHYHZENMJKMG-UHFFFAOYSA-N |
| SMILES | S=C(n1nnc2ccccc21)n1nnc2ccccc21 |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bis(benzotriazol-1-yl)methanethione |
| bis(1H-benzotriazol-1-yl)methanethione |
| bis(benzotriazole)methanethione |
| bis(benzotriazolyl)methanethione |
| 1,1'-(Thiocarbonyl)bis-1H-benzotriazole |
| MFCD00424275 |
| BIS(1-BENZOTRIAZOLYL)METHANETHIONE 97 |
| 1,1'-Thiocarbonyldibenzotriazole |