5-chloro-6,6a,12-triaza-benzo[a]anthracen-7-one structure
|
Common Name | 5-chloro-6,6a,12-triaza-benzo[a]anthracen-7-one | ||
|---|---|---|---|---|
| CAS Number | 13906-26-8 | Molecular Weight | 281.69700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-6,6a,12-triaza-benzo[a]anthracen-7-one |
|---|
| Molecular Formula | C15H8ClN3O |
|---|---|
| Molecular Weight | 281.69700 |
| Exact Mass | 281.03600 |
| PSA | 47.26000 |
| LogP | 3.04930 |
| InChIKey | MUHBDIDXVUEIHJ-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nc2c3ccccc3c(Cl)nn12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |