6-Deoxyisojacareubin structure
|
Common Name | 6-Deoxyisojacareubin | ||
|---|---|---|---|---|
| CAS Number | 26486-92-0 | Molecular Weight | 310.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6-Deoxyisojacareubin6-Deoxyisojacareubin is a PKC inhibitor that inhibits the proliferation of QGY-7703 cells in a concentration-dependent manner. 6-Deoxyisojacareubin is also a natural product that can be obtained from Garcinia nervosa. 6-Deoxyisojacareubin can be used in cancer research[1]. |
| Name | 6-deoxyisojacareubin |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Deoxyisojacareubin is a PKC inhibitor that inhibits the proliferation of QGY-7703 cells in a concentration-dependent manner. 6-Deoxyisojacareubin is also a natural product that can be obtained from Garcinia nervosa. 6-Deoxyisojacareubin can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H14O5 |
|---|---|
| Molecular Weight | 310.30 |
| Exact Mass | 310.08400 |
| PSA | 79.90000 |
| LogP | 3.54160 |
| InChIKey | XWRLBJDPJRDNKF-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2c(cc(O)c3c(=O)c4cccc(O)c4oc23)O1 |
| Storage condition | 2-8℃ |
| 6-deoxyjacareubin |
| 6-deoxyjacreubin |
| 6,11-Dihydroxy-3,3-dimethyl-3H-4,12-dioxa-benzo[a]anthracen-7-one |
| 6,11-dihydroxy-3,3-dimethylpyrano[2,3-c]xanthen-7(3H)-one |
| 6-Deoxyisojacareubin |
| 6,11-dihydroxy-3,3-dimethyl-3H,7H-pyrano[2,3-c]-xanthen-7-one |