3-(4-acetylphenyl)-1-(2-chloroethyl)urea structure
|
Common Name | 3-(4-acetylphenyl)-1-(2-chloroethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 13908-48-0 | Molecular Weight | 240.68600 | |
| Density | 1.261g/cm3 | Boiling Point | 377.7ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | 1-(4-acetylphenyl)-3-(2-chloroethyl)urea |
|---|
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760 mmHg |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.68600 |
| Flash Point | 182.2ºC |
| Exact Mass | 240.06700 |
| PSA | 58.20000 |
| LogP | 2.71340 |
| Vapour Pressure | 6.61E-06mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | XKYQSDGJEOAYOC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)NCCCl)cc1 |
|
~%
3-(4-acetylphen... CAS#:13908-48-0 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |