Urea, N- (4-acetylphenyl)-N-(2-chloroethyl)-N-nitroso- structure
|
Common Name | Urea, N- (4-acetylphenyl)-N-(2-chloroethyl)-N-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 13909-27-8 | Molecular Weight | 269.68400 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-acetylphenyl)-1-(2-chloroethyl)-1-nitrosourea |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.68400 |
| Exact Mass | 269.05700 |
| PSA | 78.84000 |
| LogP | 2.71630 |
| Index of Refraction | 1.586 |
| InChIKey | ORTCFPGDEOWLRK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)N(CCCl)N=O)cc1 |
|
~%
Urea, N- (4-ace... CAS#:13909-27-8 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
|
~%
Urea, N- (4-ace... CAS#:13909-27-8 |
| Literature: Johnston; McCaleb; Opliger; Montgomery Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 892 - 911 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |