endo-BCN-PEG2-PFP ester structure
|
Common Name | endo-BCN-PEG2-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1421932-53-7 | Molecular Weight | 519.458 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 586.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H26F5NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.3±30.1 °C | |
Use of endo-BCN-PEG2-PFP esterendo-BCN-PEG2-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Pentafluorophenyl 1-(bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10-trioxa-4-azatridecan-13-oate |
|---|---|
| Synonym | More Synonyms |
| Description | endo-BCN-PEG2-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 586.2±50.0 °C at 760 mmHg |
| Molecular Formula | C24H26F5NO6 |
| Molecular Weight | 519.458 |
| Flash Point | 308.3±30.1 °C |
| Exact Mass | 519.168030 |
| LogP | 4.16 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | OQSLFTLVSWOAIW-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCNC(=O)OCC1C2CCC#CCCC21)Oc1c(F)c(F)c(F)c(F)c1F |
| 2,7,10-Trioxa-4-azatridecan-13-oic acid, 1-bicyclo[6.1.0]non-4-yn-9-yl-3-oxo-, 2,3,4,5,6-pentafluorophenyl ester |
| Pentafluorophenyl 1-(bicyclo[6.1.0]non-4-yn-9-yl)-3-oxo-2,7,10-trioxa-4-azatridecan-13-oate |