1-(Trichloromethyl)-4-(trifluoromethyl)benzene structure
|
Common Name | 1-(Trichloromethyl)-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 13947-96-1 | Molecular Weight | 263.472 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 235.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H4Cl3F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.1±19.4 °C | |
| Name | 1-(Trichloromethyl)-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 235.9±35.0 °C at 760 mmHg |
| Molecular Formula | C8H4Cl3F3 |
| Molecular Weight | 263.472 |
| Flash Point | 112.1±19.4 °C |
| Exact Mass | 261.933075 |
| LogP | 3.91 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | NTFZDVDWIVFEEI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(C(Cl)(Cl)Cl)cc1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-(trichloromethyl)-4-(trifluoromethyl)- |
| 1-Trichlormethyl-4-trifluormethyl-benzol |
| 4-trifluoromethyl-1-trichloromethylbenzene |
| EINECS 237-729-0 |
| 1-trichloromethyl-4-trifluoromethylbenzene |
| 1-(Trichloromethyl)-4-(trifluoromethyl)benzene |
| 4-Trichlormethyl-benzotrifluorid |
| 4trichloromethyl-benzotrifluoride |