1,4-Bis(trifluoromethyl)benzene structure
|
Common Name | 1,4-Bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 433-19-2 | Molecular Weight | 214.108 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 116.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F6 | Melting Point | -1°C | |
| MSDS | Chinese USA | Flash Point | 21.7±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | 1,4-Bis(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 116.0±0.0 °C at 760 mmHg |
| Melting Point | -1°C |
| Molecular Formula | C8H4F6 |
| Molecular Weight | 214.108 |
| Flash Point | 21.7±0.0 °C |
| Exact Mass | 214.021713 |
| LogP | 3.83 |
| Vapour Pressure | 22.1±0.2 mmHg at 25°C |
| Index of Refraction | 1.380 |
| InChIKey | PDCBZHHORLHNCZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315-H319-H335 |
| Precautionary Statements | P210-P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Phrases | R10 |
| Safety Phrases | S16-S26-S36/37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 3 |
| HS Code | 2903999090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Vibrational Spectra of Fluorinated Aromatics. VIII. 1, 4-Bis (trifluoromethyl) benzene. Ferguson EE, et al.
J. Chem. Phys. 21(10) , 1731-35, (1953)
|
| 1,4-Bis(trifluoromethyl)benzene |
| 1,4-Bis(trifluoromethyl)-benzene |
| MFCD00000402 |
| EINECS 207-086-0 |
| α,α,α,α',α',α'-Hexafluoro-p-xylene |
| p-Trifluoromethylbenzotrifluoride |
| 1,4-Di(Trifluoromethyl)Benzene |