N-(4-Bromo-2,6-dichlorophenyl)acetamide structure
|
Common Name | N-(4-Bromo-2,6-dichlorophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 13953-09-8 | Molecular Weight | 282.949 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 381.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C8H6BrCl2NO | Melting Point | 208-209°C | |
| MSDS | N/A | Flash Point | 184.3±27.9 °C | |
| Name | n-(4-bromo-2,6-dichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.1±42.0 °C at 760 mmHg |
| Melting Point | 208-209°C |
| Molecular Formula | C8H6BrCl2NO |
| Molecular Weight | 282.949 |
| Flash Point | 184.3±27.9 °C |
| Exact Mass | 280.900970 |
| PSA | 29.10000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | VLEHCDVPBFIQSK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(Cl)cc(Br)cc1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide, N-(4-bromo-2,6-dichlorophenyl)- |
| 4-bromo-2,6-dichloroacetanilide |
| N-(4-Bromo-2,6-dichlorophenyl)acetamide |
| 2.6-Dichlor-4-brom-acetanilid |