2,4,6-tris(4-nitrophenyl)-1,3,5-triazine structure
|
Common Name | 2,4,6-tris(4-nitrophenyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 13960-34-4 | Molecular Weight | 444.35700 | |
| Density | 1.478g/cm3 | Boiling Point | 739.9ºC at 760 mmHg | |
| Molecular Formula | C21H12N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 401.3ºC | |
| Name | 2,4,6-tris(4-nitrophenyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478g/cm3 |
|---|---|
| Boiling Point | 739.9ºC at 760 mmHg |
| Molecular Formula | C21H12N6O6 |
| Molecular Weight | 444.35700 |
| Flash Point | 401.3ºC |
| Exact Mass | 444.08200 |
| PSA | 176.13000 |
| LogP | 6.16680 |
| Vapour Pressure | 7E-21mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | NCJIBBAKIPAWMQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ccc([N+](=O)[O-])cc3)nc(-c3ccc([N+](=O)[O-])cc3)n2)cc1 |
| HS Code | 2933699090 |
|---|
|
~95%
2,4,6-tris(4-ni... CAS#:13960-34-4 |
| Literature: Forsberg, John H.; Spaziano, Vincent T.; Klump, Stephen P.; Sanders, Kathleen M. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 767 - 770 |
|
~%
2,4,6-tris(4-ni... CAS#:13960-34-4 |
| Literature: Davis Journal of the Chemical Society, 1905 , vol. 87, p. 1834 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Tris-(4-nitro-phenyl)-[1,3,5]triazin |
| 2,4,6-tris-(4-nitro-phenyl)-[1,3,5]triazine |
| 2,4,6-Tri-(p-nitrophenyl)-s-triazin |
| tris-(4-nitro-phenyl)-[1,3,5]triazine |
| 2,4,6-tri-p-nitrophenyl-s-triazine |
| 2,3-DIMETHYL-2'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE |
| tri(p-nitrophenyl)-s-triazine |
| 2,4,6-Tris-(4-nitrophenyl)-1,3,5-triazin |