4-Nitrobenzonitrile structure
|
Common Name | 4-Nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 619-72-7 | Molecular Weight | 148.119 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 307.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O2 | Melting Point | 144-147 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.9±23.2 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-Nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.7±25.0 °C at 760 mmHg |
| Melting Point | 144-147 °C(lit.) |
| Molecular Formula | C7H4N2O2 |
| Molecular Weight | 148.119 |
| Flash Point | 139.9±23.2 °C |
| Exact Mass | 148.027283 |
| PSA | 69.61000 |
| LogP | 1.19 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | NKJIFDNZPGLLSH-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc([N+](=O)[O-])cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H311 + H331 |
| Precautionary Statements | P261-P264-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S36/37/39-S45-S28A-S36/37-S22 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DI4903500 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29269095 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
[A case of methemoglobinemia due to 4-nitrobenzonitrile exposure].
Med. Lav. 82(2) , 137-41, (1991) The paper describes a singular case of acute intoxication by 4-nitrobenzonitrile, a rare intermediate compound produced by pharmaceutical synthesis. The patients subsequently showed an increase in tri... |
|
|
Release of nitrite from the antitubercular nitroimidazole drug PA-824 and analogues upon one-electron reduction in protic, non-aqueous solvent.
Org. Biomol. Chem. 8(2) , 413-8, (2010) The one-electron reduction chemistry of the antituberculosis drug PA-824, together with a series of closely related compounds, has been investigated in irradiated anaerobic propan-2-ol solution. The p... |
|
|
In vitro metabolism of aromatic nitriles.
J. Pharm. Sci. 83(12) , 1729-34, (1994) Studies on the metabolic fate of aromatic nitriles, in contrast to their aliphatic counterparts, have been minimal and the subject of controversy. The in vitro metabolic fate of several aromatic nitri... |
| P-Nitro |
| 4-CYANONITROBENZENE |
| Benzonitrile,4-nitro |
| 4-nitro-benzonitril |
| p-nitrobenzoic acid nitrile |
| 4-Nitrobenzenenitrile |
| P-NITROBENZONITRILE |
| EINECS 210-610-0 |
| P-Nitrophenylacetonitrile |
| 4-Nitrobenzonitrile |
| para-nitro-benzonitrile |
| 4-Nitrobenzolcarbonitril |
| p-nitro-benzonitril |
| p-Cyanonitrobenzene |
| 4-nitrobenzylnitrile |
| Benzonitrile, 4-nitro- |
| MFCD00007279 |