4-benzyloxyphenyl isothiocyanate structure
|
Common Name | 4-benzyloxyphenyl isothiocyanate | ||
|---|---|---|---|---|
| CAS Number | 139768-71-1 | Molecular Weight | 241.30800 | |
| Density | 1.09 g/cm3 | Boiling Point | 392.9ºC at 760 mmHg | |
| Molecular Formula | C14H11NOS | Melting Point | 62 °C | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 1-isothiocyanato-4-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09 g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760 mmHg |
| Melting Point | 62 °C |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.30800 |
| Flash Point | 191.4ºC |
| Exact Mass | 241.05600 |
| PSA | 53.68000 |
| LogP | 3.99990 |
| Vapour Pressure | 5E-06mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | OQXRBXAFSXVCCO-UHFFFAOYSA-N |
| SMILES | S=C=Nc1ccc(OCc2ccccc2)cc1 |
| Hazard Codes | T |
|---|---|
| Risk Phrases | R20/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| Packaging Group | III |
| HS Code | 2930909090 |
|
~97%
4-benzyloxyphen... CAS#:139768-71-1 |
| Literature: Knaggs, Sarah; Malkin, Hugh; Osborn, Helen M.I.; Williams, Nana Aba O.; Yaqoob, Parveen Organic and Biomolecular Chemistry, 2005 , vol. 3, # 21 p. 4002 - 4010 |
|
~%
4-benzyloxyphen... CAS#:139768-71-1 |
| Literature: US5302720 A1, ; |
|
~%
4-benzyloxyphen... CAS#:139768-71-1 |
| Literature: US2263386 , ; |
|
~%
4-benzyloxyphen... CAS#:139768-71-1 |
| Literature: US2263386 , ; |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-benzyloxyisothiocyanate |
| MFCD00041095 |
| 4-phenylmethoxyphenylisothiocyanate |
| 4-Benzyloxy-phenylisothiocyanat |
| 4-BENZYLOXYPHENYL ISOTHIOCYANATE |