Urea, 1, 3-bis (2-chloropropyl)-1-nitroso-
Modify Date: 2025-09-30 22:56:51
Urea, 1, 3-bis (2-chloropropyl)-1-nitroso- structure
|
Common Name | Urea, 1, 3-bis (2-chloropropyl)-1-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 13991-79-2 | Molecular Weight | 242.10300 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H13Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(2-chloropropyl)-1-nitrosourea |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C7H13Cl2N3O2 |
| Molecular Weight | 242.10300 |
| Exact Mass | 241.03800 |
| PSA | 61.77000 |
| LogP | 2.32490 |
| Index of Refraction | 1.538 |
| InChIKey | VZFIZKSKHUIXHI-UHFFFAOYSA-N |
| SMILES | CC(Cl)CNC(=O)N(CC(C)Cl)N=O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |