UNII:55VT8U9HB1 structure
|
Common Name | UNII:55VT8U9HB1 | ||
|---|---|---|---|---|
| CAS Number | 140663-38-3 | Molecular Weight | 364.291 | |
| Density | N/A | Boiling Point | 495.3ºC at 760 mmHg | |
| Molecular Formula | C14H19Cl2N3O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 253.3ºC | |
| Name | 5-(3-methylpiperazin-1-yl)sulfonylisoquinoline,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 495.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H19Cl2N3O2S |
| Molecular Weight | 364.291 |
| Flash Point | 253.3ºC |
| Exact Mass | 363.057495 |
| PSA | 70.68000 |
| LogP | 4.16870 |
| Vapour Pressure | 6E-10mmHg at 25°C |
| InChIKey | YHYNDFTUZMEYNX-UHFFFAOYSA-N |
| SMILES | CC1CN(S(=O)(=O)c2cccc3cnccc23)CCN1.Cl.Cl |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| ISO-H7 |
| UNII:55VT8U9HB1 |
| Piperazine, 1-(5-isoquinolinylsulfonyl)-2-methyl-, dihydrochloride |
| 5-[(2-Methyl-1-piperazinyl)sulfonyl]isoquinoline dihydrochloride |
| Iso-H-7,Dihydrochloride |
| MFCD00132899 |
| 1-(5-Isoquinolinesulfonyl)-2-methyl-piperazine dihydrochloride |
| 5-[(2-Methylpiperazin-1-yl)sulfonyl]isoquinoline dihydrochloride |
| Isoquinoline, 5-[(2-methyl-1-piperazinyl)sulfonyl]-, hydrochloride (1:2) |
| 1-(5-Isoquinolinylsulfonyl)-3-methylpiperazine dihydrochloride |
| 1-(5-Isoquinolinesulfonyl)-3-methylpiperazine,2HCl |
| 1-(5-Isoquinolinylsulfonyl)-2-methylpiperazine dihydrochloride |