(6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol structure
|
Common Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 140710-90-3 | Molecular Weight | 514.89800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H58O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H58O2Si |
|---|---|
| Molecular Weight | 514.89800 |
| Exact Mass | 514.42100 |
| PSA | 29.46000 |
| LogP | 9.76340 |
| Index of Refraction | 1.508 |
| InChIKey | CTZMHDJIUFEYKE-DWSYLPIJSA-N |
| SMILES | C=C1CCC(O[Si](C)(C)C(C)(C)C)CC1=CC=C1CCCC2(C)C1CCC2C(C)CCCC(C)(C)O |
|
~%
(6R)-6-[(1R,3aS... CAS#:140710-90-3 |
| Literature: Ray, Rahul; Lambert, James R. Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 8 p. 2537 - 2540 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-O-tert-Butyldimethylsilyl-25-hydroxyvitamin D3 |
| (3|A,5Z,7E)-3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-9,10-secocholesta-5,7,10(19)-triene-25-diol |
| 3-O-TBDMS 25-OH Vitamin D3 |
| 3-O-tert-Butyldimethylsilyl-25-Hydroxycholecalciferol |
| 3-O-tert-Butyldimethylsilyl Calcifediol |