2-(6-bromohexyl)-5-nitroisoindole-1,3-dione structure
|
Common Name | 2-(6-bromohexyl)-5-nitroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 140715-57-7 | Molecular Weight | 355.18400 | |
| Density | 1.536g/cm3 | Boiling Point | 476.8ºC at 760mmHg | |
| Molecular Formula | C14H15BrN2O4 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 242.2ºC | |
| Name | 2-(6-bromohexyl)-5-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 476.8ºC at 760mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C14H15BrN2O4 |
| Molecular Weight | 355.18400 |
| Flash Point | 242.2ºC |
| Exact Mass | 354.02200 |
| PSA | 83.20000 |
| LogP | 3.60720 |
| Vapour Pressure | 2.95E-09mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | MVZFMBIPSGZNHF-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2C(=O)N1CCCCCCBr |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2925190090 |
|
~%
2-(6-bromohexyl... CAS#:140715-57-7 |
| Literature: Ishihara; Kato; Goto Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 12 p. 3225 - 3235 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione,2-(6-bromohexyl)-5-nitro |
| N-(6-Bromohexyl)-4-nitrophthalimide |
| 2-(3-AMINO-4H-THIENO[3,4-C]PYRAZOL-2(6H)-YL)-N-(TETRAHYDROFURAN-2-YLMETHYL)ACETAMIDE |