5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one structure
|
Common Name | 5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one | ||
|---|---|---|---|---|
| CAS Number | 140834-64-6 | Molecular Weight | 290.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7F9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5,6,6,7,7,8,8,8-nonafluorooctan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7F9O |
|---|---|
| Molecular Weight | 290.12600 |
| Exact Mass | 290.03500 |
| PSA | 17.07000 |
| LogP | 3.82380 |
| InChIKey | QSFHSDZDCSCCGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
|
~48%
5,5,6,6,7,7,8,8... CAS#:140834-64-6 |
| Literature: Hu, Chan-Ming; Qiu, Yao-Ling Journal of Organic Chemistry, 1992 , vol. 57, # 12 p. 3339 - 3342 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Octanone,5,5,6,6,7,7,8,8,8-nonafluoro |
| 5,5,6,6,7,7,8,8,8-Nonafluoro-2-octanone |