1,1,1,2,2,3,3,4,4-nonafluorobutane structure
|
Common Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 375-17-7 | Molecular Weight | 220.03600 | |
| Density | 1.526g/cm3 | Boiling Point | 17.9ºC at 760mmHg | |
| Molecular Formula | C4HF9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,2,3,3,4,4-nonafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526g/cm3 |
|---|---|
| Boiling Point | 17.9ºC at 760mmHg |
| Molecular Formula | C4HF9 |
| Molecular Weight | 220.03600 |
| Exact Mass | 219.99300 |
| LogP | 3.08440 |
| Index of Refraction | 1.24 |
| InChIKey | ZQTIKDIHRRLSRV-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 23 |
| RIDADR | UN 3163 |
| HS Code | 2903399090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1H-Perfluorobutane |
| 1,1,1,2,2,3,3,4,4-nonafluoro-butane |
| 1H-Nonafluor-butan |
| nonafluorobutane |
| 1H-NONAFLUOROBUTANE |
| PC0548 |