4,6-o-benzylidene-d-glucal structure
|
Common Name | 4,6-o-benzylidene-d-glucal | ||
|---|---|---|---|---|
| CAS Number | 14125-70-3 | Molecular Weight | 268.263 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 521.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7±23.6 °C | |
| Name | 4,6-o-benzylidene-d-glucal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 521.6±50.0 °C at 760 mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.263 |
| Flash Point | 201.7±23.6 °C |
| Exact Mass | 268.094696 |
| PSA | 96.22000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | XMDUTBYCCVWPLD-NDBYEHHHSA-N |
| SMILES | OC1C=COC2COC(c3ccccc3)OC12 |
| HS Code | 2932999099 |
|---|
|
~4%
4,6-o-benzylide... CAS#:14125-70-3 |
| Literature: Carbohydrate Research, , vol. 174, p. 305 - 312 |
|
~%
4,6-o-benzylide... CAS#:14125-70-3 |
| Literature: Carbohydrate Research, , vol. 337, # 17 p. 1523 - 1527 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-O-Benzylidene-D-glucose |
| 1,5-anhydro-4,6-O-benzylidene-2-deoxy-D-arabino-hex-1-enitol |
| 4,6-O-(Phenylmethylene)-D-glucose |
| 4,6-O-benzylidine-D-arabino-hex-1-enitol |
| 4,6-Benzylidene-D-glucose |
| D-Glucose, 4,6-O-(phenylmethylene)- |
| 4,6-Benzyliden-1,2-didehydro-1,2-dideoxy-D-arabino-hexopyranose |
| 4,6-O-Benzyliden-D-gulal |
| 4,6-O-benzylidene dihydro-D-glucal |