4,6-O-Benzylidene-D-glucopyranose structure
|
Common Name | 4,6-O-Benzylidene-D-glucopyranose | ||
|---|---|---|---|---|
| CAS Number | 97232-16-1 | Molecular Weight | 268.26300 | |
| Density | 1.437g/cm3 | Boiling Point | 483.395ºC at 760 mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.148ºC | |
| Name | (8R,8aS)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 483.395ºC at 760 mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26300 |
| Flash Point | 246.148ºC |
| Exact Mass | 268.09500 |
| PSA | 88.38000 |
| Index of Refraction | 1.606 |
| InChIKey | FOLRUCXBTYDAQK-SFZUHQLGSA-N |
| SMILES | OC1OC2COC(c3ccccc3)OC2C(O)C1O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-O-Benzylidene-glucopyranose |
| 4,6-O-Benzylidene-D-glucopyranose |
| D-Glucopyranose, 4,6-O-(phenylmethylene)- |
| 4,6-O-(Phenylmethylene)-D-glucopyranose |