Nabam structure
|
Common Name | Nabam | ||
|---|---|---|---|---|
| CAS Number | 142-59-6 | Molecular Weight | 256.343 | |
| Density | 1.342 g/mL at 25 °C(lit.) | Boiling Point | 308.2ºC at 760 mmHg | |
| Molecular Formula | C4H6N2Na2S4 | Melting Point | 78-81ºC | |
| MSDS | Chinese USA | Flash Point | 140.2ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | nabam |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 308.2ºC at 760 mmHg |
| Melting Point | 78-81ºC |
| Molecular Formula | C4H6N2Na2S4 |
| Molecular Weight | 256.343 |
| Flash Point | 140.2ºC |
| Exact Mass | 255.920914 |
| PSA | 138.84000 |
| LogP | 1.91220 |
| Index of Refraction | n20/D 1.532(lit.) |
| InChIKey | UQJQVUOTMVCFHX-UHFFFAOYSA-L |
| SMILES | S=C([S-])NCCNC(=S)[S-].[Na+].[Na+] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H335-H410 |
| Precautionary Statements | P261-P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39-61-60-46-24/25-8 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | FA6825000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29163900 |
| HS Code | 29163900 |
|---|
|
[Hepatic microsomal monoxygenase inhibition by nabam in the rat (author's transl)].
Toxicol. Eur. Res. 3(6) , 285-91, (1981) Nabam (fungicide dithiocarbamate) has been incorporated with the diet of rats during six months (the doses were: 0, 10, 50, 100, 500, 1000 and 2000 ppm). It decreases significantly the hepatic microso... |
|
|
Ultrastructural and histological study of degenerative changes in the antennal glands, hepatopancreas, and midgut of grass shrimp exposed to two dithiocarbamate biocides.
J. Invertebr. Pathol. 41(3) , 281-300, (1983) The histological and ultrastructural alterations observed in the antennal glands, hepatopancreas, and midgut of grass shrimp exposed to either a 50% potassium dimethyldithiocarbamate biocide (Busan-85... |
|
|
Studies on the mechanism of nabam- and zineb-induced inhibition of the hepatic microsomal monooxygenases of the male rat.
Toxicol. Appl. Pharmacol. 81(3 Pt 1) , 460-8, (1985) In vitro effects of the ethylene bis-dithiocarbamate fungicides, nabam and zineb, on the hepatic microsomal monooxygenases of male rats were examined. Incubation of nabam and zineb with hepatic micros... |
| x-spor |
| Dithane D-14 |
| Dinatriumethan-1,2-diylbis(dithiocarbamat) |
| Nabam |
| ethylenebis(dithiocarbamate) disodium salt |
| chem-bam |
| nabasan |
| MFCD00069382 |
| ent9106 |
| Carbamodithioic acid, N,N'-1,2-ethanediylbis-, sodium salt (1:2) |
| D-14(R) |
| disodium N,N’-1,2-ethanediylbis(carbamodithioate) |
| disodium N,N’-ethane-1,2-diyldicarbamodithioate |
| D-14 |
| carbond |
| EINECS 205-547-0 |
| Disodium 1,2-ethanediyldicarbamodithioate |
| disodium ethylenebis(dithiocarbamate) |
| N,N'-ethane-1,2-diyl-bis-dithiocarbamic acid,disodium salt |
| disodium ethylenebisdithiocarbamate |
| Disodium ethane-1,2-diyldicarbamodithioate |